C25H23Cl2F3N4O6S — CID 66648905
tert-butyl N-[3-[5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]pyridine-2-carbonyl]-2-pyridinyl]carbamate (PubChem CID 66648905) has the molecular formula C25H23Cl2F3N4O6S and a molecular weight of 635.45 g/mol. Its IUPAC name is tert-butyl N-[3-[5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]pyridine-2-carbonyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]pyridine-2-carbonyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 66648905 |
| Molecular Formula | C25H23Cl2F3N4O6S |
| Molecular Weight | 635.45 g/mol |
| Exact Mass | 634.07 |
| IUPAC Name | tert-butyl N-[3-[5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]pyridine-2-carbonyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncccc1C(=O)c1ncc(Cl)cc1NCOCS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23Cl2F3N4O6S/c1-24(2,3)40-23(36)34-22-16(5-4-8-31-22)21(35)20-19(9-14(26)11-32-20)33-12-39-13-41(37,38)15-6-7-18(27)17(10-15)25(28,29)30/h4-11,33H,12-13H2,1-3H3,(H,31,34,36) |
| InChIKey | NMTVUHLAOYMLRL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|