C18H31BN2O2 — CID 66649282
2-methyl-3-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butane-2,3-diamine (PubChem CID 66649282) has the molecular formula C18H31BN2O2 and a molecular weight of 318.27 g/mol. Its IUPAC name is 2-methyl-3-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butane-2,3-diamine.
| Compound Name | 2-methyl-3-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butane-2,3-diamine |
|---|---|
| PubChem CID | 66649282 |
| Molecular Formula | C18H31BN2O2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 2-methyl-3-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butane-2,3-diamine |
| SMILES | CC(NCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(C)(C)N |
| InChI | InChI=1S/C18H31BN2O2/c1-13(16(2,3)20)21-12-14-8-10-15(11-9-14)19-22-17(4,5)18(6,7)23-19/h8-11,13,21H,12,20H2,1-7H3 |
| InChIKey | NAARFUHOEBKFSV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|