About porphyrin-2-amine
porphyrin-2-amine (PubChem CID 66649713) has the molecular formula C20H13N5
and a molecular weight of 323.36 g/mol. Its IUPAC name is porphyrin-2-amine.
Molecular Properties
| Compound Name | porphyrin-2-amine |
| PubChem CID | 66649713 |
| Molecular Formula | C20H13N5 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | porphyrin-2-amine |
| SMILES | NC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C20H13N5/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11H,21H2/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11- |
| InChIKey | DCKFGDRTGUKVAM-ZFGIDIDVSA-N |
| XLogP | 2.87 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze porphyrin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of porphyrin-2-amine?
The IUPAC name of porphyrin-2-amine (CID 66649713) is porphyrin-2-amine.
What is the SMILES notation for porphyrin-2-amine?
The canonical SMILES for porphyrin-2-amine is NC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of porphyrin-2-amine?
The InChIKey is DCKFGDRTGUKVAM-ZFGIDIDVSA-N. The full InChI is InChI=1S/C20H13N5/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11H,21H2/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11-.
What are the key properties of porphyrin-2-amine?
porphyrin-2-amine has a molecular weight of 323.36 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for porphyrin-2-amine is sourced from PubChem (CID 66649713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).