C25H35F4N3O5S — CID 66649788
(1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-oxothian-4-ol (PubChem CID 66649788) has the molecular formula C25H35F4N3O5S and a molecular weight of 565.63 g/mol. Its IUPAC name is (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-oxothian-4-ol.
| Compound Name | (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-oxothian-4-ol |
|---|---|
| PubChem CID | 66649788 |
| Molecular Formula | C25H35F4N3O5S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-oxothian-4-ol |
| SMILES | COC[C@@H](Oc1cc(C[C@@H]2C[S@@](=O)C[C@H](NCc3cc(CC(C)(C)C)on3)[C@H]2O)cc(F)c1N)C(F)(F)F |
| InChI | InChI=1S/C25H35F4N3O5S/c1-24(2,3)9-17-8-16(32-37-17)10-31-19-13-38(34)12-15(23(19)33)5-14-6-18(26)22(30)20(7-14)36-21(11-35-4)25(27,28)29/h6-8,15,19,21,23,31,33H,5,9-13,30H2,1-4H3/t15-,19+,21-,23+,38-/m1/s1 |
| InChIKey | BNFJJDOJXXRZDV-NAOLWSJMSA-N |
| XLogP | 3.38 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|