C27H44O — CID 66649819
(5E,8E)-2-[(4Z,7E)-cyclododeca-4,7-dien-1-yl]-2,6,10,10-tetramethyl-1-oxacyclododeca-5,8-diene (PubChem CID 66649819) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (5E,8E)-2-[(4Z,7E)-cyclododeca-4,7-dien-1-yl]-2,6,10,10-tetramethyl-1-oxacyclododeca-5,8-diene.
| Compound Name | (5E,8E)-2-[(4Z,7E)-cyclododeca-4,7-dien-1-yl]-2,6,10,10-tetramethyl-1-oxacyclododeca-5,8-diene |
|---|---|
| PubChem CID | 66649819 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (5E,8E)-2-[(4Z,7E)-cyclododeca-4,7-dien-1-yl]-2,6,10,10-tetramethyl-1-oxacyclododeca-5,8-diene |
| SMILES | C/C1=C\CCC(C)(C2CC/C=C\C/C=C/CCCC2)OCCC(C)(C)/C=C/C1 |
| InChI | InChI=1S/C27H44O/c1-24-16-14-20-26(2,3)22-23-28-27(4,21-15-17-24)25-18-12-10-8-6-5-7-9-11-13-19-25/h5-6,9,11,14,17,20,25H,7-8,10,12-13,15-16,18-19,21-23H2,1-4H3/b6-5+,11-9-,20-14+,24-17+ |
| InChIKey | DMEZCCXNDZDSIA-MSYPLSFASA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|