C19H18N8O2 — CID 66649976
4-[4-[5-(3-nitrophenyl)-1H-imidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine (PubChem CID 66649976) has the molecular formula C19H18N8O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 4-[4-[5-(3-nitrophenyl)-1H-imidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-[4-[5-(3-nitrophenyl)-1H-imidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 66649976 |
| Molecular Formula | C19H18N8O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[4-[5-(3-nitrophenyl)-1H-imidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(-c2cnc(C3CCN(c4ncnc5[nH]ncc45)CC3)[nH]2)c1 |
| InChI | InChI=1S/C19H18N8O2/c28-27(29)14-3-1-2-13(8-14)16-10-20-17(24-16)12-4-6-26(7-5-12)19-15-9-23-25-18(15)21-11-22-19/h1-3,8-12H,4-7H2,(H,20,24)(H,21,22,23,25) |
| InChIKey | KQBBNBYKMHRFHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|