About 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid
2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid (PubChem CID 66650437) has the molecular formula C10H10Cl2O4
and a molecular weight of 265.09 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid |
| PubChem CID | 66650437 |
| Molecular Formula | C10H10Cl2O4 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1(O)C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C10H10Cl2O4/c1-2-5(9(14)15)10(16)3-6(11)8(13)7(12)4-10/h3-5,16H,2H2,1H3,(H,14,15) |
| InChIKey | CVYVZRRCPLPNKC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid?
The IUPAC name of 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid (CID 66650437) is 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid.
What is the SMILES notation for 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid?
The canonical SMILES for 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid is CCC(C(=O)O)C1(O)C=C(Cl)C(=O)C(Cl)=C1.
What is the InChIKey of 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid?
The InChIKey is CVYVZRRCPLPNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O4/c1-2-5(9(14)15)10(16)3-6(11)8(13)7(12)4-10/h3-5,16H,2H2,1H3,(H,14,15).
What are the key properties of 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid?
2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid has a molecular weight of 265.09 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid is sourced from PubChem (CID 66650437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).