C23H28ClNO7S — CID 66650607
N-[(2R,3R,4R,5S,6R)-2-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide (PubChem CID 66650607) has the molecular formula C23H28ClNO7S and a molecular weight of 498.00 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 66650607 |
| Molecular Formula | C23H28ClNO7S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
| SMILES | O=C(NC1[C@@H](O)[C@H](O)[C@@H](CO)O[C@]1(O)CCOCCSc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H28ClNO7S/c24-16-6-8-17(9-7-16)33-13-12-31-11-10-23(30)21(20(28)19(27)18(14-26)32-23)25-22(29)15-4-2-1-3-5-15/h1-9,18-21,26-28,30H,10-14H2,(H,25,29)/t18-,19-,20+,21?,23-/m1/s1 |
| InChIKey | YAVCWZQEXQWLGY-NCEHHECNSA-N |
| XLogP | 1.44 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|