C10H8Cl4O4 — CID 66650829
2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid (PubChem CID 66650829) has the molecular formula C10H8Cl4O4 and a molecular weight of 333.98 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid.
| Compound Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid |
|---|---|
| PubChem CID | 66650829 |
| Molecular Formula | C10H8Cl4O4 |
| Molecular Weight | 333.98 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)butanoic acid |
| SMILES | CCC(C(=O)O)C1(O)C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C10H8Cl4O4/c1-2-3(9(16)17)10(18)7(13)4(11)6(15)5(12)8(10)14/h3,18H,2H2,1H3,(H,16,17) |
| InChIKey | QPNUWOVLGXSTGB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.98 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|