C14H15NO5S — CID 66650849
(2S,3R,4S,5S)-2-[[2-(furan-2-yl)-3-pyridinyl]oxy]thiane-3,4,5-triol (PubChem CID 66650849) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[[2-(furan-2-yl)-3-pyridinyl]oxy]thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[[2-(furan-2-yl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 66650849 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (2S,3R,4S,5S)-2-[[2-(furan-2-yl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](Oc2cccnc2-c2ccco2)SC[C@H]1O |
| InChI | InChI=1S/C14H15NO5S/c16-8-7-21-14(13(18)12(8)17)20-10-3-1-5-15-11(10)9-4-2-6-19-9/h1-6,8,12-14,16-18H,7H2/t8-,12+,13-,14+/m1/s1 |
| InChIKey | YRHXCJXJPKEBLU-XAGKMFGPSA-N |
| XLogP | 0.88 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |