C29H21ClINO5 — CID 6665106
(3aS,6R,11aS,11bR)-6-(5-chloro-2-hydroxyphenyl)-2-(4-iodophenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6665106) has the molecular formula C29H21ClINO5 and a molecular weight of 625.85 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-6-(5-chloro-2-hydroxyphenyl)-2-(4-iodophenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-6-(5-chloro-2-hydroxyphenyl)-2-(4-iodophenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6665106 |
| Molecular Formula | C29H21ClINO5 |
| Molecular Weight | 625.85 g/mol |
| Exact Mass | 625.02 |
| IUPAC Name | (3aS,6R,11aS,11bR)-6-(5-chloro-2-hydroxyphenyl)-2-(4-iodophenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1cc(Cl)ccc1O)C1=CC[C@@H]3C(=O)N(c4ccc(I)cc4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C29H21ClINO5/c1-13-10-23(34)21-12-19-17(24(26(21)27(13)35)20-11-14(30)2-9-22(20)33)7-8-18-25(19)29(37)32(28(18)36)16-5-3-15(31)4-6-16/h2-7,9-11,18-19,24-25,33H,8,12H2,1H3/t18-,19+,24+,25-/m0/s1 |
| InChIKey | YIWWKKANJUMOOU-MKTUGGFXSA-N |
| XLogP | 5.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|