C21H24N2O8S — CID 66651476
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[6-(3,5-dimethyl-1,2-oxazol-4-yl)-3-pyridinyl]oxy]thian-3-yl] acetate (PubChem CID 66651476) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[6-(3,5-dimethyl-1,2-oxazol-4-yl)-3-pyridinyl]oxy]thian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[6-(3,5-dimethyl-1,2-oxazol-4-yl)-3-pyridinyl]oxy]thian-3-yl] acetate |
|---|---|
| PubChem CID | 66651476 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[6-(3,5-dimethyl-1,2-oxazol-4-yl)-3-pyridinyl]oxy]thian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CS[C@H]1Oc1ccc(-c2c(C)noc2C)nc1 |
| InChI | InChI=1S/C21H24N2O8S/c1-10-18(11(2)31-23-10)16-7-6-15(8-22-16)30-21-20(29-14(5)26)19(28-13(4)25)17(9-32-21)27-12(3)24/h6-8,17,19-21H,9H2,1-5H3/t17-,19+,20-,21-/m1/s1 |
| InChIKey | JZXKKTJPZSXDEP-GFOJFJKKSA-N |
| XLogP | 2.60 |
| TPSA | 127.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|