C11H15ClIN — CID 66651510
[(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine;hydrochloride (PubChem CID 66651510) has the molecular formula C11H15ClIN and a molecular weight of 323.61 g/mol. Its IUPAC name is [(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine;hydrochloride.
| Compound Name | [(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 66651510 |
| Molecular Formula | C11H15ClIN |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | [(1R)-6-iodo-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C11H14IN.ClH/c12-10-4-5-11-8(6-10)2-1-3-9(11)7-13;/h4-6,9H,1-3,7,13H2;1H/t9-;/m0./s1 |
| InChIKey | FMQGWBPNIGQDBW-FVGYRXGTSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|