About tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate
tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate (PubChem CID 66651681) has the molecular formula C25H29NO5
and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate |
| PubChem CID | 66651681 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N1C(=O)c2ccc(OCc3ccccc3)cc2C1=O)C(C)(C)C |
| InChI | InChI=1S/C25H29NO5/c1-24(2,3)20(23(29)31-25(4,5)6)26-21(27)18-13-12-17(14-19(18)22(26)28)30-15-16-10-8-7-9-11-16/h7-14,20H,15H2,1-6H3/t20-/m1/s1 |
| InChIKey | DRXFETZYOFNKLK-HXUWFJFHSA-N |
| XLogP | 4.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate?
The IUPAC name of tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate (CID 66651681) is tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate.
What is the SMILES notation for tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate?
The canonical SMILES for tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate is CC(C)(C)OC(=O)[C@@H](N1C(=O)c2ccc(OCc3ccccc3)cc2C1=O)C(C)(C)C.
What is the InChIKey of tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate?
The InChIKey is DRXFETZYOFNKLK-HXUWFJFHSA-N. The full InChI is InChI=1S/C25H29NO5/c1-24(2,3)20(23(29)31-25(4,5)6)26-21(27)18-13-12-17(14-19(18)22(26)28)30-15-16-10-8-7-9-11-16/h7-14,20H,15H2,1-6H3/t20-/m1/s1.
What are the key properties of tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate?
tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate has a molecular weight of 423.51 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(1,3-dioxo-5-phenylmethoxyisoindol-2-yl)-3,3-dimethylbutanoate is sourced from PubChem (CID 66651681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).