About 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline
8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline (PubChem CID 66651790) has the molecular formula C19H15ClN2
and a molecular weight of 306.80 g/mol. Its IUPAC name is 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline.
Molecular Properties
| Compound Name | 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline |
| PubChem CID | 66651790 |
| Molecular Formula | C19H15ClN2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline |
| SMILES | Cc1ccc2[nH]c(C)c(-c3ccnc4c(Cl)cccc34)c2c1 |
| InChI | InChI=1S/C19H15ClN2/c1-11-6-7-17-15(10-11)18(12(2)22-17)13-8-9-21-19-14(13)4-3-5-16(19)20/h3-10,22H,1-2H3 |
| InChIKey | GVGVYZOEICLLLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline?
The IUPAC name of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline (CID 66651790) is 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline.
What is the SMILES notation for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline?
The canonical SMILES for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline is Cc1ccc2[nH]c(C)c(-c3ccnc4c(Cl)cccc34)c2c1.
What is the InChIKey of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline?
The InChIKey is GVGVYZOEICLLLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN2/c1-11-6-7-17-15(10-11)18(12(2)22-17)13-8-9-21-19-14(13)4-3-5-16(19)20/h3-10,22H,1-2H3.
What are the key properties of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline?
8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline has a molecular weight of 306.80 g/mol, XLogP of 5.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline is sourced from PubChem (CID 66651790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).