About 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline
4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline (PubChem CID 66651924) has the molecular formula C21H20N2
and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline.
Molecular Properties
| Compound Name | 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline |
| PubChem CID | 66651924 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline |
| SMILES | Cc1ccc2[nH]c(C)c(-c3ccnc4c(C)cc(C)cc34)c2c1 |
| InChI | InChI=1S/C21H20N2/c1-12-5-6-19-18(10-12)20(15(4)23-19)16-7-8-22-21-14(3)9-13(2)11-17(16)21/h5-11,23H,1-4H3 |
| InChIKey | OXUCXGPSOQFAIU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline?
The IUPAC name of 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline (CID 66651924) is 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline.
What is the SMILES notation for 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline?
The canonical SMILES for 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline is Cc1ccc2[nH]c(C)c(-c3ccnc4c(C)cc(C)cc34)c2c1.
What is the InChIKey of 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline?
The InChIKey is OXUCXGPSOQFAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2/c1-12-5-6-19-18(10-12)20(15(4)23-19)16-7-8-22-21-14(3)9-13(2)11-17(16)21/h5-11,23H,1-4H3.
What are the key properties of 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline?
4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline has a molecular weight of 300.41 g/mol, XLogP of 5.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethyl-1H-indol-3-yl)-6,8-dimethylquinoline is sourced from PubChem (CID 66651924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).