C31H34FN3O3 — CID 66652156
3-[[8-[4-(4-fluorophenyl)butyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzoic acid (PubChem CID 66652156) has the molecular formula C31H34FN3O3 and a molecular weight of 515.63 g/mol. Its IUPAC name is 3-[[8-[4-(4-fluorophenyl)butyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[8-[4-(4-fluorophenyl)butyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 66652156 |
| Molecular Formula | C31H34FN3O3 |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 3-[[8-[4-(4-fluorophenyl)butyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CN(c3ccccc3)C3(CCN(CCCCc4ccc(F)cc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C31H34FN3O3/c32-27-14-12-24(13-15-27)7-4-5-18-33-19-16-31(17-20-33)30(38)34(23-35(31)28-10-2-1-3-11-28)22-25-8-6-9-26(21-25)29(36)37/h1-3,6,8-15,21H,4-5,7,16-20,22-23H2,(H,36,37) |
| InChIKey | YTKONWQJCRTGKF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|