About 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid
5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid (PubChem CID 66652343) has the molecular formula C11H7F2N3O2
and a molecular weight of 251.19 g/mol. Its IUPAC name is 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid |
| PubChem CID | 66652343 |
| Molecular Formula | C11H7F2N3O2 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid |
| SMILES | Nc1cnc(-c2c(F)cccc2F)nc1C(=O)O |
| InChI | InChI=1S/C11H7F2N3O2/c12-5-2-1-3-6(13)8(5)10-15-4-7(14)9(16-10)11(17)18/h1-4H,14H2,(H,17,18) |
| InChIKey | FEVPVEKDQNSDEK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid?
The IUPAC name of 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid (CID 66652343) is 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid?
The canonical SMILES for 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid is Nc1cnc(-c2c(F)cccc2F)nc1C(=O)O.
What is the InChIKey of 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid?
The InChIKey is FEVPVEKDQNSDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2N3O2/c12-5-2-1-3-6(13)8(5)10-15-4-7(14)9(16-10)11(17)18/h1-4H,14H2,(H,17,18).
What are the key properties of 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid?
5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid has a molecular weight of 251.19 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,6-difluorophenyl)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 66652343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).