C28H35NO3 — CID 66652661
3-[3-hydroxy-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]-1-piperidin-1-ylpropan-1-one (PubChem CID 66652661) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 3-[3-hydroxy-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-[3-hydroxy-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 66652661 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 3-[3-hydroxy-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]-1-piperidin-1-ylpropan-1-one |
| SMILES | O=C(CCc1cc2c(cc1O)C1CCCCC1C(c1ccc(O)cc1)C2)N1CCCCC1 |
| InChI | InChI=1S/C28H35NO3/c30-22-11-8-19(9-12-22)25-17-21-16-20(10-13-28(32)29-14-4-1-5-15-29)27(31)18-26(21)24-7-3-2-6-23(24)25/h8-9,11-12,16,18,23-25,30-31H,1-7,10,13-15,17H2 |
| InChIKey | YGCDKCXLJWORGN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |