About 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one
5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one (PubChem CID 66652703) has the molecular formula C15H21FN2O5Si
and a molecular weight of 356.43 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one |
| PubChem CID | 66652703 |
| Molecular Formula | C15H21FN2O5Si |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one |
| SMILES | CC1OC(c2ccncc2[N+](=O)[O-])C(F)C(=O)C1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H21FN2O5Si/c1-9-15(2,23-24(3,4)5)14(19)12(16)13(22-9)10-6-7-17-8-11(10)18(20)21/h6-9,12-13H,1-5H3 |
| InChIKey | KAPCQHAGWCMURU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one?
The IUPAC name of 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one (CID 66652703) is 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one.
What is the SMILES notation for 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one?
The canonical SMILES for 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one is CC1OC(c2ccncc2[N+](=O)[O-])C(F)C(=O)C1(C)O[Si](C)(C)C.
What is the InChIKey of 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one?
The InChIKey is KAPCQHAGWCMURU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN2O5Si/c1-9-15(2,23-24(3,4)5)14(19)12(16)13(22-9)10-6-7-17-8-11(10)18(20)21/h6-9,12-13H,1-5H3.
What are the key properties of 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one?
5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one has a molecular weight of 356.43 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dimethyl-6-(3-nitro-4-pyridinyl)-3-trimethylsilyloxyoxan-4-one is sourced from PubChem (CID 66652703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).