About 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol
6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol (PubChem CID 66653004) has the molecular formula C18H31FN2O3Si
and a molecular weight of 370.54 g/mol. Its IUPAC name is 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol.
Molecular Properties
| Compound Name | 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol |
| PubChem CID | 66653004 |
| Molecular Formula | C18H31FN2O3Si |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol |
| SMILES | CC1OC(c2ccncc2N)C(F)C(O[Si](C)(C)C(C)(C)C)C1(C)O |
| InChI | InChI=1S/C18H31FN2O3Si/c1-11-18(5,22)16(24-25(6,7)17(2,3)4)14(19)15(23-11)12-8-9-21-10-13(12)20/h8-11,14-16,22H,20H2,1-7H3 |
| InChIKey | RLCXIBVIZKXIJT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol?
The IUPAC name of 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol (CID 66653004) is 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol.
What is the SMILES notation for 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol?
The canonical SMILES for 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol is CC1OC(c2ccncc2N)C(F)C(O[Si](C)(C)C(C)(C)C)C1(C)O.
What is the InChIKey of 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol?
The InChIKey is RLCXIBVIZKXIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31FN2O3Si/c1-11-18(5,22)16(24-25(6,7)17(2,3)4)14(19)15(23-11)12-8-9-21-10-13(12)20/h8-11,14-16,22H,20H2,1-7H3.
What are the key properties of 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol?
6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol has a molecular weight of 370.54 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-amino-4-pyridinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-2,3-dimethyloxan-3-ol is sourced from PubChem (CID 66653004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).