C20H31N5O10 — CID 66653583
pyrrole-2,5-dione;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 66653583) has the molecular formula C20H31N5O10 and a molecular weight of 501.49 g/mol. Its IUPAC name is pyrrole-2,5-dione;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | pyrrole-2,5-dione;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 66653583 |
| Molecular Formula | C20H31N5O10 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | pyrrole-2,5-dione;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C16H28N4O8.C4H3NO2/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;6-3-1-2-4(7)5-3/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);1-2H,(H,5,6,7) |
| InChIKey | GGMLLMKDCMHEAB-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 208.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|