C9H16N2S2 — CID 66653789
3-methyl-1,5-bis(methylsulfanyl)cyclohexa-3,5-diene-1,2-diamine (PubChem CID 66653789) has the molecular formula C9H16N2S2 and a molecular weight of 216.38 g/mol. Its IUPAC name is 3-methyl-1,5-bis(methylsulfanyl)cyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 3-methyl-1,5-bis(methylsulfanyl)cyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 66653789 |
| Molecular Formula | C9H16N2S2 |
| Molecular Weight | 216.38 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-methyl-1,5-bis(methylsulfanyl)cyclohexa-3,5-diene-1,2-diamine |
| SMILES | CSC1=CC(N)(SC)C(N)C(C)=C1 |
| InChI | InChI=1S/C9H16N2S2/c1-6-4-7(12-2)5-9(11,13-3)8(6)10/h4-5,8H,10-11H2,1-3H3 |
| InChIKey | CCPGMJVVJPFTNR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|