About (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate
(2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate (PubChem CID 66654028) has the molecular formula C20H21NO2
and a molecular weight of 307.39 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate |
| PubChem CID | 66654028 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate |
| SMILES | Cc1cc(C)c(COC(=O)N2C=Cc3ccccc3C2)c(C)c1 |
| InChI | InChI=1S/C20H21NO2/c1-14-10-15(2)19(16(3)11-14)13-23-20(22)21-9-8-17-6-4-5-7-18(17)12-21/h4-11H,12-13H2,1-3H3 |
| InChIKey | VIWBHDCHKFBRDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate?
The IUPAC name of (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate (CID 66654028) is (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate.
What is the SMILES notation for (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate?
The canonical SMILES for (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate is Cc1cc(C)c(COC(=O)N2C=Cc3ccccc3C2)c(C)c1.
What is the InChIKey of (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate?
The InChIKey is VIWBHDCHKFBRDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO2/c1-14-10-15(2)19(16(3)11-14)13-23-20(22)21-9-8-17-6-4-5-7-18(17)12-21/h4-11H,12-13H2,1-3H3.
What are the key properties of (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate?
(2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate has a molecular weight of 307.39 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trimethylphenyl)methyl 1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 66654028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).