About 7-methyl-5,8-diazaspiro[2.6]nonane
7-methyl-5,8-diazaspiro[2.6]nonane (PubChem CID 66654182) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 7-methyl-5,8-diazaspiro[2.6]nonane.
Molecular Properties
| Compound Name | 7-methyl-5,8-diazaspiro[2.6]nonane |
| PubChem CID | 66654182 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 7-methyl-5,8-diazaspiro[2.6]nonane |
| SMILES | CC1CNCC2(CC2)CN1 |
| InChI | InChI=1S/C8H16N2/c1-7-4-9-5-8(2-3-8)6-10-7/h7,9-10H,2-6H2,1H3 |
| InChIKey | USOOMPJLYFCIKO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-5,8-diazaspiro[2.6]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,8-diazaspiro[2.6]nonane?
The IUPAC name of 7-methyl-5,8-diazaspiro[2.6]nonane (CID 66654182) is 7-methyl-5,8-diazaspiro[2.6]nonane.
What is the SMILES notation for 7-methyl-5,8-diazaspiro[2.6]nonane?
The canonical SMILES for 7-methyl-5,8-diazaspiro[2.6]nonane is CC1CNCC2(CC2)CN1.
What is the InChIKey of 7-methyl-5,8-diazaspiro[2.6]nonane?
The InChIKey is USOOMPJLYFCIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-7-4-9-5-8(2-3-8)6-10-7/h7,9-10H,2-6H2,1H3.
What are the key properties of 7-methyl-5,8-diazaspiro[2.6]nonane?
7-methyl-5,8-diazaspiro[2.6]nonane has a molecular weight of 140.23 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,8-diazaspiro[2.6]nonane is sourced from PubChem (CID 66654182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).