About 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid
2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid (PubChem CID 66654274) has the molecular formula C22H24ClN3O3
and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid.
Molecular Properties
| Compound Name | 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid |
| PubChem CID | 66654274 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid |
| SMILES | CCC(Cl)C(C(=O)O)(C1=Nc2ccccc2Oc2ccccc21)C1CNCCN1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-2-18(23)22(21(27)28,19-13-24-11-12-25-19)20-14-7-3-5-9-16(14)29-17-10-6-4-8-15(17)26-20/h3-10,18-19,24-25H,2,11-13H2,1H3,(H,27,28) |
| InChIKey | DDYVXIIQDYIEMO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid?
The IUPAC name of 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid (CID 66654274) is 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid.
What is the SMILES notation for 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid?
The canonical SMILES for 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid is CCC(Cl)C(C(=O)O)(C1=Nc2ccccc2Oc2ccccc21)C1CNCCN1.
What is the InChIKey of 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid?
The InChIKey is DDYVXIIQDYIEMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN3O3/c1-2-18(23)22(21(27)28,19-13-24-11-12-25-19)20-14-7-3-5-9-16(14)29-17-10-6-4-8-15(17)26-20/h3-10,18-19,24-25H,2,11-13H2,1H3,(H,27,28).
What are the key properties of 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid?
2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid has a molecular weight of 413.91 g/mol, XLogP of 3.56, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzo[b][1,4]benzoxazepin-6-yl-3-chloro-2-piperazin-2-ylpentanoic acid is sourced from PubChem (CID 66654274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).