About 2,5-dipentyl-1,3-dihydropyrazole
2,5-dipentyl-1,3-dihydropyrazole (PubChem CID 66654838) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 2,5-dipentyl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 2,5-dipentyl-1,3-dihydropyrazole |
| PubChem CID | 66654838 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2,5-dipentyl-1,3-dihydropyrazole |
| SMILES | CCCCCC1=CCN(CCCCC)N1 |
| InChI | InChI=1S/C13H26N2/c1-3-5-7-9-13-10-12-15(14-13)11-8-6-4-2/h10,14H,3-9,11-12H2,1-2H3 |
| InChIKey | SLRFLWHCZWBHGE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dipentyl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dipentyl-1,3-dihydropyrazole?
The IUPAC name of 2,5-dipentyl-1,3-dihydropyrazole (CID 66654838) is 2,5-dipentyl-1,3-dihydropyrazole.
What is the SMILES notation for 2,5-dipentyl-1,3-dihydropyrazole?
The canonical SMILES for 2,5-dipentyl-1,3-dihydropyrazole is CCCCCC1=CCN(CCCCC)N1.
What is the InChIKey of 2,5-dipentyl-1,3-dihydropyrazole?
The InChIKey is SLRFLWHCZWBHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-3-5-7-9-13-10-12-15(14-13)11-8-6-4-2/h10,14H,3-9,11-12H2,1-2H3.
What are the key properties of 2,5-dipentyl-1,3-dihydropyrazole?
2,5-dipentyl-1,3-dihydropyrazole has a molecular weight of 210.36 g/mol, XLogP of 3.46, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipentyl-1,3-dihydropyrazole is sourced from PubChem (CID 66654838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).