C21H24N6O2S2 — CID 666552
7-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione (PubChem CID 666552) has the molecular formula C21H24N6O2S2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 7-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione.
| Compound Name | 7-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 666552 |
| Molecular Formula | C21H24N6O2S2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 7-[3-(1,3-benzothiazol-2-ylsulfanyl)propyl]-3-methyl-8-piperidin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCCCC1)n2CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H24N6O2S2/c1-25-17-16(18(28)24-20(25)29)27(19(23-17)26-10-5-2-6-11-26)12-7-13-30-21-22-14-8-3-4-9-15(14)31-21/h3-4,8-9H,2,5-7,10-13H2,1H3,(H,24,28,29) |
| InChIKey | GYHULBHSEIWTON-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|