C19H20FN3O4 — CID 66655312
3-(4,4a-dihydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl)-5-fluoro-4-pyridin-3-ylpyridine-2-carboxamide (PubChem CID 66655312) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is 3-(4,4a-dihydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl)-5-fluoro-4-pyridin-3-ylpyridine-2-carboxamide.
| Compound Name | 3-(4,4a-dihydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl)-5-fluoro-4-pyridin-3-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 66655312 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3-(4,4a-dihydroxy-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyran-2-yl)-5-fluoro-4-pyridin-3-ylpyridine-2-carboxamide |
| SMILES | NC(=O)c1ncc(F)c(-c2cccnc2)c1C1CC(O)C2(O)CCCC2O1 |
| InChI | InChI=1S/C19H20FN3O4/c20-11-9-23-17(18(21)25)16(15(11)10-3-2-6-22-8-10)12-7-13(24)19(26)5-1-4-14(19)27-12/h2-3,6,8-9,12-14,24,26H,1,4-5,7H2,(H2,21,25) |
| InChIKey | WKLGWPDIGIKIJZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |