C31H33F3N4O5 — CID 66655589
butyl 7-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-4a-hydroxy-5-methyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[4,3-b]pyridine-1-carboxylate (PubChem CID 66655589) has the molecular formula C31H33F3N4O5 and a molecular weight of 598.62 g/mol. Its IUPAC name is butyl 7-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-4a-hydroxy-5-methyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[4,3-b]pyridine-1-carboxylate.
| Compound Name | butyl 7-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-4a-hydroxy-5-methyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[4,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 66655589 |
| Molecular Formula | C31H33F3N4O5 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | butyl 7-[3-[[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]amino]-4-pyridinyl]-4a-hydroxy-5-methyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[4,3-b]pyridine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC2(O)C(C)OC(c3ccncc3NC(=O)c3ccc(F)c(-c4c(F)cccc4F)n3)CC12 |
| InChI | InChI=1S/C31H33F3N4O5/c1-3-4-15-42-30(40)38-14-6-12-31(41)18(2)43-25(16-26(31)38)19-11-13-35-17-24(19)37-29(39)23-10-9-22(34)28(36-23)27-20(32)7-5-8-21(27)33/h5,7-11,13,17-18,25-26,41H,3-4,6,12,14-16H2,1-2H3,(H,37,39) |
| InChIKey | MFEIZJFIPSVIBW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|