About 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride
3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride (PubChem CID 66655594) has the molecular formula C23H26ClNO3
and a molecular weight of 399.92 g/mol. Its IUPAC name is 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride |
| PubChem CID | 66655594 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCN1CCC2(CC1)COc1cc(C=Cc3ccccc3)ccc12 |
| InChI | InChI=1S/C23H25NO3.ClH/c25-22(26)10-13-24-14-11-23(12-15-24)17-27-21-16-19(8-9-20(21)23)7-6-18-4-2-1-3-5-18;/h1-9,16H,10-15,17H2,(H,25,26);1H |
| InChIKey | UANMWNSEADZKSO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride?
The IUPAC name of 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride (CID 66655594) is 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride.
What is the SMILES notation for 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride?
The canonical SMILES for 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride is Cl.O=C(O)CCN1CCC2(CC1)COc1cc(C=Cc3ccccc3)ccc12.
What is the InChIKey of 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride?
The InChIKey is UANMWNSEADZKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO3.ClH/c25-22(26)10-13-24-14-11-23(12-15-24)17-27-21-16-19(8-9-20(21)23)7-6-18-4-2-1-3-5-18;/h1-9,16H,10-15,17H2,(H,25,26);1H.
What are the key properties of 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride?
3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride has a molecular weight of 399.92 g/mol, XLogP of 4.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2-phenylethenyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;hydrochloride is sourced from PubChem (CID 66655594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).