C27H28F3N3O7 — CID 66656052
3-[6-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 66656052) has the molecular formula C27H28F3N3O7 and a molecular weight of 563.53 g/mol. Its IUPAC name is 3-[6-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[6-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66656052 |
| Molecular Formula | C27H28F3N3O7 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 3-[6-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methoxy]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(-c2ccc(COc3ccc4c(c3)OCC43CCN(CCC(=O)O)CC3)cc2)no1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H27N3O5.C2HF3O2/c1-17-26-24(27-33-17)19-4-2-18(3-5-19)15-31-20-6-7-21-22(14-20)32-16-25(21)9-12-28(13-10-25)11-8-23(29)30;3-2(4,5)1(6)7/h2-7,14H,8-13,15-16H2,1H3,(H,29,30);(H,6,7) |
| InChIKey | QBRQHEKVKDZCOQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |