C20H32O7 — CID 66656877
[5-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-methylprop-2-enoate (PubChem CID 66656877) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is [5-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-methylprop-2-enoate.
| Compound Name | [5-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66656877 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | [5-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C(C2COC(CC)(CC)O2)OC2OC(CC)(CC)OC21 |
| InChI | InChI=1S/C20H32O7/c1-7-19(8-2)22-11-13(25-19)14-15(23-17(21)12(5)6)16-18(24-14)27-20(9-3,10-4)26-16/h13-16,18H,5,7-11H2,1-4,6H3 |
| InChIKey | DWFIIYSCAZNSRR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|