C20H28O7 — CID 66656891
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 66656891) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 66656891 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3C2OC(=O)C2CC3C=CC2C3)O1 |
| InChI | InChI=1S/C20H28O7/c1-19(2)22-9-13(25-19)14-15(16-18(24-14)27-20(3,4)26-16)23-17(21)12-8-10-5-6-11(12)7-10/h5-6,10-16,18H,7-9H2,1-4H3 |
| InChIKey | OXDBVOKCBMYKFK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|