C5H4N4 — CID 66657040
5H-pyrrolo[2,3-e][1,2,4]triazine (PubChem CID 66657040) has the molecular formula C5H4N4 and a molecular weight of 120.11 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-e][1,2,4]triazine.
| Compound Name | 5H-pyrrolo[2,3-e][1,2,4]triazine |
|---|---|
| PubChem CID | 66657040 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 5H-pyrrolo[2,3-e][1,2,4]triazine |
| SMILES | c1nnc2cc[nH]c2n1 |
| InChI | InChI=1S/C5H4N4/c1-2-6-5-4(1)9-8-3-7-5/h1-3H,(H,6,7,8) |
| InChIKey | JZWZBMIWJCNAOR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |