About Pyrroloquinoline quinone disodium salt
Pyrroloquinoline quinone disodium salt (PubChem CID 66657480) has the molecular formula C14H6N2Na2O8
and a molecular weight of 376.19 g/mol.
Molecular Properties
| Compound Name | Pyrroloquinoline quinone disodium salt |
| PubChem CID | 66657480 |
| Molecular Formula | C14H6N2Na2O8 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(C(=O)O)c2c(n1)C(=O)C(=O)c1cc(C(=O)O)[nH]c1-2.[Na].[Na] |
| InChI | InChI=1S/C14H6N2O8.2Na/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18;;/h1-2,15H,(H,19,20)(H,21,22)(H,23,24);; |
| InChIKey | MKPHMOAXBWUCGG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 174.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze Pyrroloquinoline quinone disodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pyrroloquinoline quinone disodium salt?
The IUPAC name of Pyrroloquinoline quinone disodium salt (CID 66657480) is not available.
What is the SMILES notation for Pyrroloquinoline quinone disodium salt?
The canonical SMILES for Pyrroloquinoline quinone disodium salt is O=C(O)c1cc(C(=O)O)c2c(n1)C(=O)C(=O)c1cc(C(=O)O)[nH]c1-2.[Na].[Na].
What is the InChIKey of Pyrroloquinoline quinone disodium salt?
The InChIKey is MKPHMOAXBWUCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N2O8.2Na/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18;;/h1-2,15H,(H,19,20)(H,21,22)(H,23,24);;.
What are the key properties of Pyrroloquinoline quinone disodium salt?
Pyrroloquinoline quinone disodium salt has a molecular weight of 376.19 g/mol, XLogP of -0.21, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Pyrroloquinoline quinone disodium salt is sourced from PubChem (CID 66657480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).