About 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol
2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol (PubChem CID 66657806) has the molecular formula C11H18BrN3OS
and a molecular weight of 320.26 g/mol. Its IUPAC name is 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol |
| PubChem CID | 66657806 |
| Molecular Formula | C11H18BrN3OS |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol |
| SMILES | CC1CN(c2ncc(Br)s2)CC(C)N1CCO |
| InChI | InChI=1S/C11H18BrN3OS/c1-8-6-14(11-13-5-10(12)17-11)7-9(2)15(8)3-4-16/h5,8-9,16H,3-4,6-7H2,1-2H3 |
| InChIKey | OIGGDZJHXVFCSF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol?
The IUPAC name of 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol (CID 66657806) is 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol is CC1CN(c2ncc(Br)s2)CC(C)N1CCO.
What is the InChIKey of 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol?
The InChIKey is OIGGDZJHXVFCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrN3OS/c1-8-6-14(11-13-5-10(12)17-11)7-9(2)15(8)3-4-16/h5,8-9,16H,3-4,6-7H2,1-2H3.
What are the key properties of 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol?
2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol has a molecular weight of 320.26 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-bromo-1,3-thiazol-2-yl)-2,6-dimethylpiperazin-1-yl]ethanol is sourced from PubChem (CID 66657806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).