About [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate
[3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate (PubChem CID 66657979) has the molecular formula C30H32N2O3S
and a molecular weight of 500.66 g/mol. Its IUPAC name is [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate.
Molecular Properties
| Compound Name | [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate |
| PubChem CID | 66657979 |
| Molecular Formula | C30H32N2O3S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1cccc(OCCC2CCN(c3nc4ccc(-c5ccccc5)cc4s3)CC2)c1 |
| InChI | InChI=1S/C30H32N2O3S/c1-2-7-29(33)35-26-11-6-10-25(21-26)34-19-16-22-14-17-32(18-15-22)30-31-27-13-12-24(20-28(27)36-30)23-8-4-3-5-9-23/h3-6,8-13,20-22H,2,7,14-19H2,1H3 |
| InChIKey | GTFPKGSDWPMLCF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate?
The IUPAC name of [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate (CID 66657979) is [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate.
What is the SMILES notation for [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate?
The canonical SMILES for [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate is CCCC(=O)Oc1cccc(OCCC2CCN(c3nc4ccc(-c5ccccc5)cc4s3)CC2)c1.
What is the InChIKey of [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate?
The InChIKey is GTFPKGSDWPMLCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O3S/c1-2-7-29(33)35-26-11-6-10-25(21-26)34-19-16-22-14-17-32(18-15-22)30-31-27-13-12-24(20-28(27)36-30)23-8-4-3-5-9-23/h3-6,8-13,20-22H,2,7,14-19H2,1H3.
What are the key properties of [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate?
[3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate has a molecular weight of 500.66 g/mol, XLogP of 7.35, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[1-(6-phenyl-1,3-benzothiazol-2-yl)piperidin-4-yl]ethoxy]phenyl] butanoate is sourced from PubChem (CID 66657979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).