C24H23N5O4 — CID 66658239
[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-benzylcarbamic acid (PubChem CID 66658239) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is [3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-benzylcarbamic acid.
| Compound Name | [3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 66658239 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-benzylcarbamic acid |
| SMILES | NN(C(=O)C(O)C(c1ccccc1)N(Cc1ccccc1)C(=O)O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C24H23N5O4/c25-29(18-11-12-19-20(13-18)27-15-26-19)23(31)22(30)21(17-9-5-2-6-10-17)28(24(32)33)14-16-7-3-1-4-8-16/h1-13,15,21-22,30H,14,25H2,(H,26,27)(H,32,33) |
| InChIKey | MFGXQPASHSUANU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|