About 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid
2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid (PubChem CID 66658365) has the molecular formula C23H26ClN3O2S
and a molecular weight of 444.00 g/mol. Its IUPAC name is 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid |
| PubChem CID | 66658365 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid |
| SMILES | CC(NCc1cccc(CC(=O)O)c1)C1CCN(c2nc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C23H26ClN3O2S/c1-15(25-14-17-4-2-3-16(11-17)12-22(28)29)18-7-9-27(10-8-18)23-26-20-6-5-19(24)13-21(20)30-23/h2-6,11,13,15,18,25H,7-10,12,14H2,1H3,(H,28,29) |
| InChIKey | LUINWTMQTMWMAL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid?
The IUPAC name of 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid (CID 66658365) is 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid.
What is the SMILES notation for 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid?
The canonical SMILES for 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid is CC(NCc1cccc(CC(=O)O)c1)C1CCN(c2nc3ccc(Cl)cc3s2)CC1.
What is the InChIKey of 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid?
The InChIKey is LUINWTMQTMWMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26ClN3O2S/c1-15(25-14-17-4-2-3-16(11-17)12-22(28)29)18-7-9-27(10-8-18)23-26-20-6-5-19(24)13-21(20)30-23/h2-6,11,13,15,18,25H,7-10,12,14H2,1H3,(H,28,29).
What are the key properties of 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid?
2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid has a molecular weight of 444.00 g/mol, XLogP of 4.97, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[1-[1-(6-chloro-1,3-benzothiazol-2-yl)piperidin-4-yl]ethylamino]methyl]phenyl]acetic acid is sourced from PubChem (CID 66658365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).