C21H26OSi2 — CID 66658430
6,6-bis(ethenyl)-3,3-dimethyl-2,2-diphenyloxadisilinane (PubChem CID 66658430) has the molecular formula C21H26OSi2 and a molecular weight of 350.61 g/mol. Its IUPAC name is 6,6-bis(ethenyl)-3,3-dimethyl-2,2-diphenyloxadisilinane.
| Compound Name | 6,6-bis(ethenyl)-3,3-dimethyl-2,2-diphenyloxadisilinane |
|---|---|
| PubChem CID | 66658430 |
| Molecular Formula | C21H26OSi2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 6,6-bis(ethenyl)-3,3-dimethyl-2,2-diphenyloxadisilinane |
| SMILES | C=CC1(C=C)CC[Si](C)(C)[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C21H26OSi2/c1-5-21(6-2)17-18-23(3,4)24(22-21,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h5-16H,1-2,17-18H2,3-4H3 |
| InChIKey | IKZNSMVWVIHGRB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|