About 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane
1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane (PubChem CID 66658460) has the molecular formula C19H36O3Si
and a molecular weight of 340.58 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane.
Molecular Properties
| Compound Name | 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane |
| PubChem CID | 66658460 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane |
| SMILES | C1=C(C2=CCCCCC2)CCCCC1.CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C14H22.C5H14O3Si/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-5-9(6-2,7-3)8-4/h9,11H,1-8,10,12H2;5H2,1-4H3 |
| InChIKey | KYJYRKPSNSFMSD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane?
The IUPAC name of 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane (CID 66658460) is 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane.
What is the SMILES notation for 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane?
The canonical SMILES for 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane is C1=C(C2=CCCCCC2)CCCCC1.CC[Si](OC)(OC)OC.
What is the InChIKey of 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane?
The InChIKey is KYJYRKPSNSFMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C5H14O3Si/c1-2-6-10-13(9-5-1)14-11-7-3-4-8-12-14;1-5-9(6-2,7-3)8-4/h9,11H,1-8,10,12H2;5H2,1-4H3.
What are the key properties of 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane?
1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane has a molecular weight of 340.58 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohepten-1-yl)cycloheptene;ethyl(trimethoxy)silane is sourced from PubChem (CID 66658460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).