About 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine
5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine (PubChem CID 66658462) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine.
Analyze 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine?
The IUPAC name of 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine (CID 66658462) is 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine.
What is the SMILES notation for 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine?
The canonical SMILES for 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine is C1=CC2=C(CCCN2)SC1.
What is the InChIKey of 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine?
The InChIKey is YCINJOWJGQNVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-4-8-7(9-5-1)3-2-6-10-8/h2-3,9H,1,4-6H2.
What are the key properties of 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine?
5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine has a molecular weight of 153.25 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydro-2H-thiopyrano[3,2-b]pyridine is sourced from PubChem (CID 66658462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).