C46H44Cl4N2O4 — CID 66658605
4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)-2-ethylphenyl]-2-(4-methoxyphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 66658605) has the molecular formula C46H44Cl4N2O4 and a molecular weight of 830.68 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)-2-ethylphenyl]-2-(4-methoxyphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)-2-ethylphenyl]-2-(4-methoxyphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 66658605 |
| Molecular Formula | C46H44Cl4N2O4 |
| Molecular Weight | 830.68 g/mol |
| Exact Mass | 828.21 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[4-(dimethylamino)-2-ethylphenyl]-2-(4-methoxyphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | CCc1cc(N(C)C)ccc1/C(=C/C1(/C=C(\c2ccc(OC)cc2)c2ccc(N(C)C)cc2CC)OC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21)c1ccc(OC)cc1 |
| InChI | InChI=1S/C46H44Cl4N2O4/c1-9-27-23-31(51(3)4)15-21-35(27)37(29-11-17-33(54-7)18-12-29)25-46(40-39(45(53)56-46)41(47)43(49)44(50)42(40)48)26-38(30-13-19-34(55-8)20-14-30)36-22-16-32(52(5)6)24-28(36)10-2/h11-26H,9-10H2,1-8H3/b37-25+,38-26+ |
| InChIKey | XDTWMGYFBRWTMX-USKKBRKXSA-N |
| XLogP | 12.20 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.68 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|