C31H45ClFN7O — CID 66658761
(1R,2R,3S,5R)-2-[[5-chloro-2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 66658761) has the molecular formula C31H45ClFN7O and a molecular weight of 586.20 g/mol. Its IUPAC name is (1R,2R,3S,5R)-2-[[5-chloro-2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 66658761 |
| Molecular Formula | C31H45ClFN7O |
| Molecular Weight | 586.20 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[4-[4-(diethylamino)piperidin-1-yl]-3-fluoroanilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CCN(CC)C1CCN(c2ccc(Nc3ncc(Cl)c(N[C@@]4(C)[C@@H](C(=O)NC)C[C@H]5C[C@@H]4C5(C)C)n3)cc2F)CC1 |
| InChI | InChI=1S/C31H45ClFN7O/c1-7-39(8-2)21-11-13-40(14-12-21)25-10-9-20(17-24(25)33)36-29-35-18-23(32)27(37-29)38-31(5)22(28(41)34-6)15-19-16-26(31)30(19,3)4/h9-10,17-19,21-22,26H,7-8,11-16H2,1-6H3,(H,34,41)(H2,35,36,37,38)/t19-,22+,26+,31-/m0/s1 |
| InChIKey | LTBQZFSJSMCEGQ-MZPISRKQSA-N |
| XLogP | 5.92 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.20 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|