About 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole
5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 66658868) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 66658868 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC1C=CC(CC2CN=CN2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-9-2-4-10(5-3-9)6-11-7-12-8-13-11/h2,4,8-11H,3,5-7H2,1H3,(H,12,13) |
| InChIKey | NUSAPYFMYRZPJZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole (CID 66658868) is 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole is CC1C=CC(CC2CN=CN2)CC1.
What is the InChIKey of 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole?
The InChIKey is NUSAPYFMYRZPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-2-4-10(5-3-9)6-11-7-12-8-13-11/h2,4,8-11H,3,5-7H2,1H3,(H,12,13).
What are the key properties of 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole?
5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole has a molecular weight of 178.28 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 66658868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).