C27H34ClF3N6O — CID 66658991
(1R,2R,3S,5R)-2-[[2-[3-chloro-4-(4,4-difluoropiperidin-1-yl)anilino]-5-fluoropyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 66658991) has the molecular formula C27H34ClF3N6O and a molecular weight of 551.06 g/mol. Its IUPAC name is (1R,2R,3S,5R)-2-[[2-[3-chloro-4-(4,4-difluoropiperidin-1-yl)anilino]-5-fluoropyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5R)-2-[[2-[3-chloro-4-(4,4-difluoropiperidin-1-yl)anilino]-5-fluoropyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 66658991 |
| Molecular Formula | C27H34ClF3N6O |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (1R,2R,3S,5R)-2-[[2-[3-chloro-4-(4,4-difluoropiperidin-1-yl)anilino]-5-fluoropyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@H]2C[C@H](C2(C)C)[C@@]1(C)Nc1nc(Nc2ccc(N3CCC(F)(F)CC3)c(Cl)c2)ncc1F |
| InChI | InChI=1S/C27H34ClF3N6O/c1-25(2)15-11-17(23(38)32-4)26(3,21(25)12-15)36-22-19(29)14-33-24(35-22)34-16-5-6-20(18(28)13-16)37-9-7-27(30,31)8-10-37/h5-6,13-15,17,21H,7-12H2,1-4H3,(H,32,38)(H2,33,34,35,36)/t15-,17+,21+,26-/m0/s1 |
| InChIKey | MATIIJWRBNMPBT-QCNKJMDGSA-N |
| XLogP | 5.85 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|