C7H11N3 — CID 66659174
2,3,5,6,7,8-hexahydropyrido[4,3-c]pyridazine (PubChem CID 66659174) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydropyrido[4,3-c]pyridazine.
| Compound Name | 2,3,5,6,7,8-hexahydropyrido[4,3-c]pyridazine |
|---|---|
| PubChem CID | 66659174 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2,3,5,6,7,8-hexahydropyrido[4,3-c]pyridazine |
| SMILES | C1=C2CNCCC2=NNC1 |
| InChI | InChI=1S/C7H11N3/c1-4-9-10-7-2-3-8-5-6(1)7/h1,8-9H,2-5H2 |
| InChIKey | HUWGPCQMZGSBQY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |