C13H22N2 — CID 66659577
5-[(3,5,5-trimethylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 66659577) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-[(3,5,5-trimethylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 5-[(3,5,5-trimethylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 66659577 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 5-[(3,5,5-trimethylcyclohex-2-en-1-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | CC1=CC(CC2CN=CN2)CC(C)(C)C1 |
| InChI | InChI=1S/C13H22N2/c1-10-4-11(7-13(2,3)6-10)5-12-8-14-9-15-12/h4,9,11-12H,5-8H2,1-3H3,(H,14,15) |
| InChIKey | UOSAKMWNKIQCKJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|