About (2S)-2-aminopropanoic acid;1,1'-biphenyl
(2S)-2-aminopropanoic acid;1,1'-biphenyl (PubChem CID 66659859) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;1,1'-biphenyl.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;1,1'-biphenyl |
| PubChem CID | 66659859 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2S)-2-aminopropanoic acid;1,1'-biphenyl |
| SMILES | C[C@H](N)C(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H7NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(4)3(5)6/h1-10H;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | SYVLFLAPCRVTTO-WNQIDUERSA-N |
| XLogP | 2.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-aminopropanoic acid;1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;1,1'-biphenyl?
The IUPAC name of (2S)-2-aminopropanoic acid;1,1'-biphenyl (CID 66659859) is (2S)-2-aminopropanoic acid;1,1'-biphenyl.
What is the SMILES notation for (2S)-2-aminopropanoic acid;1,1'-biphenyl?
The canonical SMILES for (2S)-2-aminopropanoic acid;1,1'-biphenyl is C[C@H](N)C(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2S)-2-aminopropanoic acid;1,1'-biphenyl?
The InChIKey is SYVLFLAPCRVTTO-WNQIDUERSA-N. The full InChI is InChI=1S/C12H10.C3H7NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(4)3(5)6/h1-10H;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminopropanoic acid;1,1'-biphenyl?
(2S)-2-aminopropanoic acid;1,1'-biphenyl has a molecular weight of 243.31 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;1,1'-biphenyl is sourced from PubChem (CID 66659859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).